C20H32F3N — CID 154668730
1-(3-heptan-4-ylphenyl)ethenamine;1,1,1-trifluoropentane (PubChem CID 154668730) has the molecular formula C20H32F3N and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-(3-heptan-4-ylphenyl)ethenamine;1,1,1-trifluoropentane.
| Compound Name | 1-(3-heptan-4-ylphenyl)ethenamine;1,1,1-trifluoropentane |
|---|---|
| PubChem CID | 154668730 |
| Molecular Formula | C20H32F3N |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1-(3-heptan-4-ylphenyl)ethenamine;1,1,1-trifluoropentane |
| SMILES | C=C(N)c1cccc(C(CCC)CCC)c1.CCCCC(F)(F)F |
| InChI | InChI=1S/C15H23N.C5H9F3/c1-4-7-13(8-5-2)15-10-6-9-14(11-15)12(3)16;1-2-3-4-5(6,7)8/h6,9-11,13H,3-5,7-8,16H2,1-2H3;2-4H2,1H3 |
| InChIKey | IENFVPMGHUALJO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |