C13H21NO — CID 83930253
3-(1-aminoheptan-4-yl)phenol (PubChem CID 83930253) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(1-aminoheptan-4-yl)phenol.
| Compound Name | 3-(1-aminoheptan-4-yl)phenol |
|---|---|
| PubChem CID | 83930253 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-(1-aminoheptan-4-yl)phenol |
| SMILES | CCCC(CCCN)c1cccc(O)c1 |
| InChI | InChI=1S/C13H21NO/c1-2-5-11(7-4-9-14)12-6-3-8-13(15)10-12/h3,6,8,10-11,15H,2,4-5,7,9,14H2,1H3 |
| InChIKey | MZILJZSSNHAICK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |