About formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol
formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol (PubChem CID 145109835) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol.
Molecular Properties
| Compound Name | formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol |
| PubChem CID | 145109835 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol |
| SMILES | C=O.CCCCC(CO)CCCc1cc(NC)ccc1C |
| InChI | InChI=1S/C17H29NO.CH2O/c1-4-5-7-15(13-19)8-6-9-16-12-17(18-3)11-10-14(16)2;1-2/h10-12,15,18-19H,4-9,13H2,1-3H3;1H2 |
| InChIKey | CHHOYHGCIBGMJA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol?
The IUPAC name of formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol (CID 145109835) is formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol.
What is the SMILES notation for formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol?
The canonical SMILES for formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol is C=O.CCCCC(CO)CCCc1cc(NC)ccc1C.
What is the InChIKey of formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol?
The InChIKey is CHHOYHGCIBGMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO.CH2O/c1-4-5-7-15(13-19)8-6-9-16-12-17(18-3)11-10-14(16)2;1-2/h10-12,15,18-19H,4-9,13H2,1-3H3;1H2.
What are the key properties of formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol?
formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol has a molecular weight of 293.45 g/mol, XLogP of 3.97, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-[3-[2-methyl-5-(methylamino)phenyl]propyl]hexan-1-ol is sourced from PubChem (CID 145109835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).