C25H42N4O2 — CID 102416260
1-(2-ethylhex-5-enyl)-3-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]urea (PubChem CID 102416260) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 1-(2-ethylhex-5-enyl)-3-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]urea.
| Compound Name | 1-(2-ethylhex-5-enyl)-3-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 102416260 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 1-(2-ethylhex-5-enyl)-3-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]urea |
| SMILES | C=CCCC(CC)CNC(=O)Nc1ccc(C)c(NC(=O)NCC(CC)CCCC)c1 |
| InChI | InChI=1S/C25H42N4O2/c1-6-10-12-20(8-3)17-26-24(30)28-22-15-14-19(5)23(16-22)29-25(31)27-18-21(9-4)13-11-7-2/h6,14-16,20-21H,1,7-13,17-18H2,2-5H3,(H2,26,28,30)(H2,27,29,31) |
| InChIKey | MBSZYURWLDYAGN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|