C20H33N5O2 — CID 155029541
methyl 2-amino-N-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]-2-methyliminoethanimidate (PubChem CID 155029541) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is methyl 2-amino-N-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]-2-methyliminoethanimidate.
| Compound Name | methyl 2-amino-N-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]-2-methyliminoethanimidate |
|---|---|
| PubChem CID | 155029541 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | methyl 2-amino-N-[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]-2-methyliminoethanimidate |
| SMILES | CCCCC(CC)CNC(=O)Nc1cc(/N=C(OC)/C(N)=N/C)ccc1C |
| InChI | InChI=1S/C20H33N5O2/c1-6-8-9-15(7-2)13-23-20(26)25-17-12-16(11-10-14(17)3)24-19(27-5)18(21)22-4/h10-12,15H,6-9,13H2,1-5H3,(H2,21,22)(H2,23,25,26)/b24-19- |
| InChIKey | OHUOUAHOZJCXCQ-CLCOLTQESA-N |
| XLogP | 4.00 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|