C23H38N4O4 — CID 58918485
ethyl 3-[[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]carbamoylamino]butanoate (PubChem CID 58918485) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is ethyl 3-[[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]carbamoylamino]butanoate.
| Compound Name | ethyl 3-[[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 58918485 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | ethyl 3-[[3-(2-ethylhexylcarbamoylamino)-4-methylphenyl]carbamoylamino]butanoate |
| SMILES | CCCCC(CC)CNC(=O)Nc1cc(NC(=O)NC(C)CC(=O)OCC)ccc1C |
| InChI | InChI=1S/C23H38N4O4/c1-6-9-10-18(7-2)15-24-22(29)27-20-14-19(12-11-16(20)4)26-23(30)25-17(5)13-21(28)31-8-3/h11-12,14,17-18H,6-10,13,15H2,1-5H3,(H2,24,27,29)(H2,25,26,30) |
| InChIKey | XJKDOZCLQFOPQX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |