C15H25P — CID 142857882
1-(3,4-dimethylphenyl)ethylidenephosphane;pentane (PubChem CID 142857882) has the molecular formula C15H25P and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)ethylidenephosphane;pentane.
| Compound Name | 1-(3,4-dimethylphenyl)ethylidenephosphane;pentane |
|---|---|
| PubChem CID | 142857882 |
| Molecular Formula | C15H25P |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)ethylidenephosphane;pentane |
| SMILES | CCCCC.[H]/P=C(\C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H13P.C5H12/c1-7-4-5-10(9(3)11)6-8(7)2;1-3-5-4-2/h4-6,11H,1-3H3;3-5H2,1-2H3 |
| InChIKey | UILKUIIPXWDBKK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|