C24H33NS — CID 144794779
1,2-dimethyl-4-(1-methylsulfanylethenyl)benzene;5-ethyl-2-methyl-4-(2-methylprop-2-enyl)aniline (PubChem CID 144794779) has the molecular formula C24H33NS and a molecular weight of 367.60 g/mol. Its IUPAC name is 1,2-dimethyl-4-(1-methylsulfanylethenyl)benzene;5-ethyl-2-methyl-4-(2-methylprop-2-enyl)aniline.
| Compound Name | 1,2-dimethyl-4-(1-methylsulfanylethenyl)benzene;5-ethyl-2-methyl-4-(2-methylprop-2-enyl)aniline |
|---|---|
| PubChem CID | 144794779 |
| Molecular Formula | C24H33NS |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1,2-dimethyl-4-(1-methylsulfanylethenyl)benzene;5-ethyl-2-methyl-4-(2-methylprop-2-enyl)aniline |
| SMILES | C=C(C)Cc1cc(C)c(N)cc1CC.C=C(SC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H19N.C11H14S/c1-5-11-8-13(14)10(4)7-12(11)6-9(2)3;1-8-5-6-11(7-9(8)2)10(3)12-4/h7-8H,2,5-6,14H2,1,3-4H3;5-7H,3H2,1-2,4H3 |
| InChIKey | DQKWGVBUHXMPOO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|