C5H9NO — CID 163955629
O-(3-methylbuta-1,3-dien-2-yl)hydroxylamine (PubChem CID 163955629) has the molecular formula C5H9NO and a molecular weight of 99.13 g/mol. Its IUPAC name is O-(3-methylbuta-1,3-dien-2-yl)hydroxylamine.
| Compound Name | O-(3-methylbuta-1,3-dien-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 163955629 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | O-(3-methylbuta-1,3-dien-2-yl)hydroxylamine |
| SMILES | C=C(C)C(=C)ON |
| InChI | InChI=1S/C5H9NO/c1-4(2)5(3)7-6/h1,3,6H2,2H3 |
| InChIKey | SDCDHYBRXYHBHM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|