About acetic acid;amino acetate;ethene
acetic acid;amino acetate;ethene (PubChem CID 174964224) has the molecular formula C8H17NO6
and a molecular weight of 223.22 g/mol. Its IUPAC name is acetic acid;amino acetate;ethene.
Molecular Properties
| Compound Name | acetic acid;amino acetate;ethene |
| PubChem CID | 174964224 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | acetic acid;amino acetate;ethene |
| SMILES | C=C.CC(=O)O.CC(=O)O.CC(=O)ON |
| InChI | InChI=1S/C2H5NO2.2C2H4O2.C2H4/c1-2(4)5-3;2*1-2(3)4;1-2/h3H2,1H3;2*1H3,(H,3,4);1-2H2 |
| InChIKey | GBPKSTMDWIOTIZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;amino acetate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;amino acetate;ethene?
The IUPAC name of acetic acid;amino acetate;ethene (CID 174964224) is acetic acid;amino acetate;ethene.
What is the SMILES notation for acetic acid;amino acetate;ethene?
The canonical SMILES for acetic acid;amino acetate;ethene is C=C.CC(=O)O.CC(=O)O.CC(=O)ON.
What is the InChIKey of acetic acid;amino acetate;ethene?
The InChIKey is GBPKSTMDWIOTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.2C2H4O2.C2H4/c1-2(4)5-3;2*1-2(3)4;1-2/h3H2,1H3;2*1H3,(H,3,4);1-2H2.
What are the key properties of acetic acid;amino acetate;ethene?
acetic acid;amino acetate;ethene has a molecular weight of 223.22 g/mol, XLogP of 0.41, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;amino acetate;ethene is sourced from PubChem (CID 174964224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).