C17H19BF4O2 — CID 171109918
2-[1-fluoro-2-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171109918) has the molecular formula C17H19BF4O2 and a molecular weight of 342.14 g/mol. Its IUPAC name is 2-[1-fluoro-2-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171109918 |
| Molecular Formula | C17H19BF4O2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[1-fluoro-2-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(c1ccc(C=C(F)B2OC(C)(C)C(C)(C)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H19BF4O2/c1-11(17(20,21)22)13-8-6-12(7-9-13)10-14(19)18-23-15(2,3)16(4,5)24-18/h6-10H,1H2,2-5H3 |
| InChIKey | VQACDDZUZIMAJN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|