C17H21BFNO2 — CID 171111007
3-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-yn-1-amine (PubChem CID 171111007) has the molecular formula C17H21BFNO2 and a molecular weight of 301.17 g/mol. Its IUPAC name is 3-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 171111007 |
| Molecular Formula | C17H21BFNO2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 3-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-yn-1-amine |
| SMILES | CC1(C)OB(C(F)=Cc2ccc(C#CCN)cc2)OC1(C)C |
| InChI | InChI=1S/C17H21BFNO2/c1-16(2)17(3,4)22-18(21-16)15(19)12-14-9-7-13(8-10-14)6-5-11-20/h7-10,12H,11,20H2,1-4H3 |
| InChIKey | SUADGTYVCXUNGR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|