C17H22BFO3S — CID 171110978
5-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pent-4-yn-1-ol (PubChem CID 171110978) has the molecular formula C17H22BFO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is 5-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pent-4-yn-1-ol.
| Compound Name | 5-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 171110978 |
| Molecular Formula | C17H22BFO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 5-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pent-4-yn-1-ol |
| SMILES | CC1(C)OB(C(F)=Cc2cc(C#CCCCO)cs2)OC1(C)C |
| InChI | InChI=1S/C17H22BFO3S/c1-16(2)17(3,4)22-18(21-16)15(19)11-14-10-13(12-23-14)8-6-5-7-9-20/h10-12,20H,5,7,9H2,1-4H3 |
| InChIKey | SCWPLRHHVPUPTN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|