C17H22BFO3S — CID 171111127
4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol (PubChem CID 171111127) has the molecular formula C17H22BFO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 171111127 |
| Molecular Formula | C17H22BFO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc(C=C(F)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C17H22BFO3S/c1-15(2,20)10-9-12-7-8-13(23-12)11-14(19)18-21-16(3,4)17(5,6)22-18/h7-8,11,20H,1-6H3 |
| InChIKey | CVOCQIONVCMEGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|