C17H19BFNO2S — CID 171110884
4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pyridine (PubChem CID 171110884) has the molecular formula C17H19BFNO2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pyridine.
| Compound Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pyridine |
|---|---|
| PubChem CID | 171110884 |
| Molecular Formula | C17H19BFNO2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]thiophen-3-yl]pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2cc(-c3ccncc3)cs2)OC1(C)C |
| InChI | InChI=1S/C17H19BFNO2S/c1-16(2)17(3,4)22-18(21-16)15(19)10-14-9-13(11-23-14)12-5-7-20-8-6-12/h5-11H,1-4H3 |
| InChIKey | YSQUYWXQLBFMCB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|