C11H15BFNO2S — CID 171111150
2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole (PubChem CID 171111150) has the molecular formula C11H15BFNO2S and a molecular weight of 255.12 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole.
| Compound Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 171111150 |
| Molecular Formula | C11H15BFNO2S |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole |
| SMILES | CC1(C)OB(C(F)=Cc2nccs2)OC1(C)C |
| InChI | InChI=1S/C11H15BFNO2S/c1-10(2)11(3,4)16-12(15-10)8(13)7-9-14-5-6-17-9/h5-7H,1-4H3 |
| InChIKey | CMKPKYOAGLPGBT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|