C14H20BFN2O2S — CID 171109689
2-ethylsulfanyl-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrimidine (PubChem CID 171109689) has the molecular formula C14H20BFN2O2S and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrimidine.
| Compound Name | 2-ethylsulfanyl-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrimidine |
|---|---|
| PubChem CID | 171109689 |
| Molecular Formula | C14H20BFN2O2S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-ethylsulfanyl-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrimidine |
| SMILES | CCSc1ncc(C=C(F)B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H20BFN2O2S/c1-6-21-12-17-8-10(9-18-12)7-11(16)15-19-13(2,3)14(4,5)20-15/h7-9H,6H2,1-5H3 |
| InChIKey | QPQVDZBTAOHRNR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|