C14H16BClFN3O2 — CID 171110269
3-chloro-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 171110269) has the molecular formula C14H16BClFN3O2 and a molecular weight of 323.56 g/mol. Its IUPAC name is 3-chloro-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-chloro-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 171110269 |
| Molecular Formula | C14H16BClFN3O2 |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-chloro-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2cnc3n[nH]c(Cl)c3c2)OC1(C)C |
| InChI | InChI=1S/C14H16BClFN3O2/c1-13(2)14(3,4)22-15(21-13)10(17)6-8-5-9-11(16)19-20-12(9)18-7-8/h5-7H,1-4H3,(H,18,19,20) |
| InChIKey | ZIQHZNKJGHNOGW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|