C19H24BFO3 — CID 171114141
4-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]but-3-yn-1-ol (PubChem CID 171114141) has the molecular formula C19H24BFO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 4-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 171114141 |
| Molecular Formula | C19H24BFO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]but-3-yn-1-ol |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccc(C#CCCO)cc1 |
| InChI | InChI=1S/C19H24BFO3/c1-14(16-11-9-15(10-12-16)8-6-7-13-22)17(21)20-23-18(2,3)19(4,5)24-20/h9-12,22H,7,13H2,1-5H3 |
| InChIKey | QJNBTURPWVIIOJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|