C15H20BFN2O4 — CID 171111402
2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-oxo-1-pyridinyl]acetamide (PubChem CID 171111402) has the molecular formula C15H20BFN2O4 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 171111402 |
| Molecular Formula | C15H20BFN2O4 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-oxo-1-pyridinyl]acetamide |
| SMILES | CC1(C)OB(C(F)=Cc2ccc(=O)n(CC(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BFN2O4/c1-14(2)15(3,4)23-16(22-14)11(17)7-10-5-6-13(21)19(8-10)9-12(18)20/h5-8H,9H2,1-4H3,(H2,18,20) |
| InChIKey | LQFKBGOKHCQXIK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|