C13H22BNO2 — CID 143898116
N-[(1E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,4-dienyl]methanimine (PubChem CID 143898116) has the molecular formula C13H22BNO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is N-[(1E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,4-dienyl]methanimine.
| Compound Name | N-[(1E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,4-dienyl]methanimine |
|---|---|
| PubChem CID | 143898116 |
| Molecular Formula | C13H22BNO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-[(1E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-1,4-dienyl]methanimine |
| SMILES | C=N/C=C/C/C=C(\C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H22BNO2/c1-11(9-7-8-10-15-6)14-16-12(2,3)13(4,5)17-14/h8-10H,6-7H2,1-5H3/b10-8+,11-9+ |
| InChIKey | GMLDUXUEYURNDG-GFULKKFKSA-N |
| XLogP | 3.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|