C13H19BF3NO2 — CID 146981868
N-[(1Z,3E)-5,5,5-trifluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dienyl]methanimine (PubChem CID 146981868) has the molecular formula C13H19BF3NO2 and a molecular weight of 289.11 g/mol. Its IUPAC name is N-[(1Z,3E)-5,5,5-trifluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-5,5,5-trifluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 146981868 |
| Molecular Formula | C13H19BF3NO2 |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[(1Z,3E)-5,5,5-trifluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H19BF3NO2/c1-9(13(15,16)17)7-10(8-18-6)14-19-11(2,3)12(4,5)20-14/h7-8H,6H2,1-5H3/b9-7+,10-8+ |
| InChIKey | AOLUDOZGDKEUSS-FIFLTTCUSA-N |
| XLogP | 3.71 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|