C17H26BNO4S — CID 102486955
4-methyl-N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]benzenesulfonamide (PubChem CID 102486955) has the molecular formula C17H26BNO4S and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102486955 |
| Molecular Formula | C17H26BNO4S |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-methyl-N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]benzenesulfonamide |
| SMILES | C/C(=C\CNS(=O)(=O)c1ccc(C)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H26BNO4S/c1-13-7-9-15(10-8-13)24(20,21)19-12-11-14(2)18-22-16(3,4)17(5,6)23-18/h7-11,19H,12H2,1-6H3/b14-11+ |
| InChIKey | VPXAUJXACRGWCS-SDNWHVSQSA-N |
| XLogP | 2.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|