C14H19NO2S — CID 11277092
4-methyl-N-(4-methylhexa-2,3-dienyl)benzenesulfonamide (PubChem CID 11277092) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-methyl-N-(4-methylhexa-2,3-dienyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(4-methylhexa-2,3-dienyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11277092 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-methyl-N-(4-methylhexa-2,3-dienyl)benzenesulfonamide |
| SMILES | CCC(C)=C=CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19NO2S/c1-4-12(2)6-5-11-15-18(16,17)14-9-7-13(3)8-10-14/h5,7-10,15H,4,11H2,1-3H3 |
| InChIKey | LIQXEKZHLKISEH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |