C20H35BO2 — CID 154715581
4,4,5,5-tetramethyl-2-[(2E,5E)-3,6,10-trimethylundeca-2,5,9-trien-2-yl]-1,3,2-dioxaborolane (PubChem CID 154715581) has the molecular formula C20H35BO2 and a molecular weight of 318.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2E,5E)-3,6,10-trimethylundeca-2,5,9-trien-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2E,5E)-3,6,10-trimethylundeca-2,5,9-trien-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154715581 |
| Molecular Formula | C20H35BO2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2E,5E)-3,6,10-trimethylundeca-2,5,9-trien-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/C/C(C)=C(/C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H35BO2/c1-15(2)11-10-12-16(3)13-14-17(4)18(5)21-22-19(6,7)20(8,9)23-21/h11,13H,10,12,14H2,1-9H3/b16-13+,18-17- |
| InChIKey | LWXVXMRHAPATCP-XJQDBPQSSA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|