C21H31B2NO5 — CID 122230898
N-phenyl-3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enamide (PubChem CID 122230898) has the molecular formula C21H31B2NO5 and a molecular weight of 399.11 g/mol. Its IUPAC name is N-phenyl-3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enamide.
| Compound Name | N-phenyl-3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 122230898 |
| Molecular Formula | C21H31B2NO5 |
| Molecular Weight | 399.11 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-phenyl-3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enamide |
| SMILES | CC1(C)OB(C(=CC(=O)Nc2ccccc2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C21H31B2NO5/c1-18(2)19(3,4)27-22(26-18)16(23-28-20(5,6)21(7,8)29-23)14-17(25)24-15-12-10-9-11-13-15/h9-14H,1-8H3,(H,24,25) |
| InChIKey | YXZBVAXGZVVOSP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|