C11H20BNO2 — CID 174069659
N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]buta-1,3-dien-2-amine (PubChem CID 174069659) has the molecular formula C11H20BNO2 and a molecular weight of 209.10 g/mol. Its IUPAC name is N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]buta-1,3-dien-2-amine.
| Compound Name | N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 174069659 |
| Molecular Formula | C11H20BNO2 |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H20BNO2/c1-7-9(2)13-8-12-14-10(3,4)11(5,6)15-12/h7,13H,1-2,8H2,3-6H3 |
| InChIKey | UGYMUIHEKYHSLU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|