C17H23BO3 — CID 159957998
2-[(6E)-6-(1-methoxyprop-2-enylidene)-5-methylidenecyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159957998) has the molecular formula C17H23BO3 and a molecular weight of 286.18 g/mol. Its IUPAC name is 2-[(6E)-6-(1-methoxyprop-2-enylidene)-5-methylidenecyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(6E)-6-(1-methoxyprop-2-enylidene)-5-methylidenecyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159957998 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-[(6E)-6-(1-methoxyprop-2-enylidene)-5-methylidenecyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C/C(OC)=c1/c(B2OC(C)(C)C(C)(C)O2)cccc1=C |
| InChI | InChI=1S/C17H23BO3/c1-8-14(19-7)15-12(2)10-9-11-13(15)18-20-16(3,4)17(5,6)21-18/h8-11H,1-2H2,3-7H3/b15-14- |
| InChIKey | SRXNFTZDRIWZQU-PFONDFGASA-N |
| XLogP | 1.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|