C12H18BNO4 — CID 174199606
2-(3-amino-2-methoxyphenyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-ol (PubChem CID 174199606) has the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 2-(3-amino-2-methoxyphenyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-ol.
| Compound Name | 2-(3-amino-2-methoxyphenyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-ol |
|---|---|
| PubChem CID | 174199606 |
| Molecular Formula | C12H18BNO4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(3-amino-2-methoxyphenyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-ol |
| SMILES | COc1c(N)cccc1B1OC(C)(C)C(C)(O)O1 |
| InChI | InChI=1S/C12H18BNO4/c1-11(2)12(3,15)18-13(17-11)8-6-5-7-9(14)10(8)16-4/h5-7,15H,14H2,1-4H3 |
| InChIKey | SMDCHKWWWJYKSU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|