C14H18BClO5 — CID 164895654
2-chloro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 164895654) has the molecular formula C14H18BClO5 and a molecular weight of 312.56 g/mol. Its IUPAC name is 2-chloro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-chloro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 164895654 |
| Molecular Formula | C14H18BClO5 |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-chloro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | COc1c(B2OC(C)(C)C(C)(C)O2)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H18BClO5/c1-13(2)14(3,4)21-15(20-13)9-7-6-8(12(17)18)10(16)11(9)19-5/h6-7H,1-5H3,(H,17,18) |
| InChIKey | PUXZNIIVBVCJEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|