C18H32BBrO2 — CID 134979397
2-[(Z)-1-bromo-5-methylideneundec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134979397) has the molecular formula C18H32BBrO2 and a molecular weight of 371.17 g/mol. Its IUPAC name is 2-[(Z)-1-bromo-5-methylideneundec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-1-bromo-5-methylideneundec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134979397 |
| Molecular Formula | C18H32BBrO2 |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[(Z)-1-bromo-5-methylideneundec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(CCCCCC)/C(=C\CCBr)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H32BBrO2/c1-7-8-9-10-12-15(2)16(13-11-14-20)19-21-17(3,4)18(5,6)22-19/h13H,2,7-12,14H2,1,3-6H3/b16-13+ |
| InChIKey | KYKRBSMCJPJTLG-DTQAZKPQSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|