C19H37BO2 — CID 100969381
4,4,5,5-tetramethyl-2-[(Z)-2-methyldodec-1-enyl]-1,3,2-dioxaborolane (PubChem CID 100969381) has the molecular formula C19H37BO2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-2-methyldodec-1-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-2-methyldodec-1-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 100969381 |
| Molecular Formula | C19H37BO2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-2-methyldodec-1-enyl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCCC/C(C)=C\B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H37BO2/c1-7-8-9-10-11-12-13-14-15-17(2)16-20-21-18(3,4)19(5,6)22-20/h16H,7-15H2,1-6H3/b17-16- |
| InChIKey | QGUBKZBDXBSVLI-MSUUIHNZSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|