C18H36BClO2Si — CID 135053340
chloro-dimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane (PubChem CID 135053340) has the molecular formula C18H36BClO2Si and a molecular weight of 358.84 g/mol. Its IUPAC name is chloro-dimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane.
| Compound Name | chloro-dimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane |
|---|---|
| PubChem CID | 135053340 |
| Molecular Formula | C18H36BClO2Si |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | chloro-dimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane |
| SMILES | CCCCCCCC/C(=C/B1OC(C)(C)C(C)(C)O1)[Si](C)(C)Cl |
| InChI | InChI=1S/C18H36BClO2Si/c1-8-9-10-11-12-13-14-16(23(6,7)20)15-19-21-17(2,3)18(4,5)22-19/h15H,8-14H2,1-7H3/b16-15- |
| InChIKey | PYZYWGYCTIADCE-NXVVXOECSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|