C16H28BBrO2 — CID 166442552
2-(10-bromodeca-2,3-dien-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 166442552) has the molecular formula C16H28BBrO2 and a molecular weight of 343.11 g/mol. Its IUPAC name is 2-(10-bromodeca-2,3-dien-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(10-bromodeca-2,3-dien-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166442552 |
| Molecular Formula | C16H28BBrO2 |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-(10-bromodeca-2,3-dien-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC=C=C(CCCCCCBr)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H28BBrO2/c1-6-11-14(12-9-7-8-10-13-18)17-19-15(2,3)16(4,5)20-17/h6H,7-10,12-13H2,1-5H3 |
| InChIKey | YGDNSPBNFDCLHP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|