C28H46B2O4 — CID 134904589
4,4,5,5-tetramethyl-2-[(Z)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 134904589) has the molecular formula C28H46B2O4 and a molecular weight of 468.30 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904589 |
| Molecular Formula | C28H46B2O4 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCC/C(B1OC(C)(C)C(C)(C)O1)=C(/B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C28H46B2O4/c1-10-11-12-13-14-18-21-23(29-31-25(2,3)26(4,5)32-29)24(22-19-16-15-17-20-22)30-33-27(6,7)28(8,9)34-30/h15-17,19-20H,10-14,18,21H2,1-9H3/b24-23- |
| InChIKey | YGEPIFOPGVIWQO-VHXPQNKSSA-N |
| XLogP | 7.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|