C19H30O2Si — CID 101241997
(1E,5E)-2-methyl-1-phenyl-6-triethylsilyloxyhexa-1,5-dien-3-ol (PubChem CID 101241997) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (1E,5E)-2-methyl-1-phenyl-6-triethylsilyloxyhexa-1,5-dien-3-ol.
| Compound Name | (1E,5E)-2-methyl-1-phenyl-6-triethylsilyloxyhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 101241997 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (1E,5E)-2-methyl-1-phenyl-6-triethylsilyloxyhexa-1,5-dien-3-ol |
| SMILES | CC[Si](CC)(CC)O/C=C/CC(O)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C19H30O2Si/c1-5-22(6-2,7-3)21-15-11-14-19(20)17(4)16-18-12-9-8-10-13-18/h8-13,15-16,19-20H,5-7,14H2,1-4H3/b15-11+,17-16+ |
| InChIKey | GLKIWCVRICHKIL-YRICKYJRSA-N |
| XLogP | 5.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|