C16H24 — CID 102271069
[(E)-2,3,5-trimethylhept-1-enyl]benzene (PubChem CID 102271069) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is [(E)-2,3,5-trimethylhept-1-enyl]benzene.
| Compound Name | [(E)-2,3,5-trimethylhept-1-enyl]benzene |
|---|---|
| PubChem CID | 102271069 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | [(E)-2,3,5-trimethylhept-1-enyl]benzene |
| SMILES | CCC(C)CC(C)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C16H24/c1-5-13(2)11-14(3)15(4)12-16-9-7-6-8-10-16/h6-10,12-14H,5,11H2,1-4H3/b15-12+ |
| InChIKey | FASGXTITXNPEDR-NTCAYCPXSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |