C13H15FO — CID 102579772
(1E,3R)-5-fluoro-2-methyl-1-phenylhexa-1,5-dien-3-ol (PubChem CID 102579772) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is (1E,3R)-5-fluoro-2-methyl-1-phenylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3R)-5-fluoro-2-methyl-1-phenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 102579772 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1E,3R)-5-fluoro-2-methyl-1-phenylhexa-1,5-dien-3-ol |
| SMILES | C=C(F)C[C@@H](O)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C13H15FO/c1-10(13(15)9-11(2)14)8-12-6-4-3-5-7-12/h3-8,13,15H,2,9H2,1H3/b10-8+/t13-/m1/s1 |
| InChIKey | CLJMSCKOQVDLTA-AORWBKJGSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |