C18H19NO3 — CID 134952898
phenyl N-[(E,2S)-2-hydroxy-3-methyl-4-phenylbut-3-enyl]carbamate (PubChem CID 134952898) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is phenyl N-[(E,2S)-2-hydroxy-3-methyl-4-phenylbut-3-enyl]carbamate.
| Compound Name | phenyl N-[(E,2S)-2-hydroxy-3-methyl-4-phenylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 134952898 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | phenyl N-[(E,2S)-2-hydroxy-3-methyl-4-phenylbut-3-enyl]carbamate |
| SMILES | C/C(=C\c1ccccc1)[C@H](O)CNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-14(12-15-8-4-2-5-9-15)17(20)13-19-18(21)22-16-10-6-3-7-11-16/h2-12,17,20H,13H2,1H3,(H,19,21)/b14-12+/t17-/m1/s1 |
| InChIKey | XIQRVFKUIYKSBP-ABDJAZHISA-N |
| XLogP | 3.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |