C13H19NO3 — CID 113258696
phenyl N-(2-hydroxy-4-methylpentyl)carbamate (PubChem CID 113258696) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is phenyl N-(2-hydroxy-4-methylpentyl)carbamate.
| Compound Name | phenyl N-(2-hydroxy-4-methylpentyl)carbamate |
|---|---|
| PubChem CID | 113258696 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | phenyl N-(2-hydroxy-4-methylpentyl)carbamate |
| SMILES | CC(C)CC(O)CNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H19NO3/c1-10(2)8-11(15)9-14-13(16)17-12-6-4-3-5-7-12/h3-7,10-11,15H,8-9H2,1-2H3,(H,14,16) |
| InChIKey | VHOPBDMBNSLYMS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |