C12H14 — CID 14247244
[(1Z)-2-methylpenta-1,4-dienyl]benzene (PubChem CID 14247244) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is [(1Z)-2-methylpenta-1,4-dienyl]benzene.
| Compound Name | [(1Z)-2-methylpenta-1,4-dienyl]benzene |
|---|---|
| PubChem CID | 14247244 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | [(1Z)-2-methylpenta-1,4-dienyl]benzene |
| SMILES | C=CC/C(C)=C\c1ccccc1 |
| InChI | InChI=1S/C12H14/c1-3-7-11(2)10-12-8-5-4-6-9-12/h3-6,8-10H,1,7H2,2H3/b11-10- |
| InChIKey | HEFNUDYLWGTPRK-KHPPLWFESA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|