C16H24OSi — CID 101449379
[(E,4E)-4-benzylidenehex-1-enoxy]-trimethylsilane (PubChem CID 101449379) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is [(E,4E)-4-benzylidenehex-1-enoxy]-trimethylsilane.
| Compound Name | [(E,4E)-4-benzylidenehex-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101449379 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(E,4E)-4-benzylidenehex-1-enoxy]-trimethylsilane |
| SMILES | CC/C(=C\c1ccccc1)C/C=C/O[Si](C)(C)C |
| InChI | InChI=1S/C16H24OSi/c1-5-15(12-9-13-17-18(2,3)4)14-16-10-7-6-8-11-16/h6-11,13-14H,5,12H2,1-4H3/b13-9+,15-14+ |
| InChIKey | CEOAIFUEXNHJPK-BBXOWAOSSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|