C17H32O2Si3 — CID 172796480
[dimethyl(1-phenylbut-1-en-2-yl)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 172796480) has the molecular formula C17H32O2Si3 and a molecular weight of 352.70 g/mol. Its IUPAC name is [dimethyl(1-phenylbut-1-en-2-yl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(1-phenylbut-1-en-2-yl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 172796480 |
| Molecular Formula | C17H32O2Si3 |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [dimethyl(1-phenylbut-1-en-2-yl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | CCC(=Cc1ccccc1)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H32O2Si3/c1-9-17(15-16-13-11-10-12-14-16)21(5,6)19-22(7,8)18-20(2,3)4/h10-15H,9H2,1-8H3 |
| InChIKey | QGRDGXQURWRJFU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|