C23H52O5Si7 — CID 175704298
trimethyl-[[2-phenyl-1-tris(trimethylsilyloxy)silylethenyl]-trimethylsilyloxysilyl]oxysilane (PubChem CID 175704298) has the molecular formula C23H52O5Si7 and a molecular weight of 605.27 g/mol. Its IUPAC name is trimethyl-[[2-phenyl-1-tris(trimethylsilyloxy)silylethenyl]-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[[2-phenyl-1-tris(trimethylsilyloxy)silylethenyl]-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 175704298 |
| Molecular Formula | C23H52O5Si7 |
| Molecular Weight | 605.27 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | trimethyl-[[2-phenyl-1-tris(trimethylsilyloxy)silylethenyl]-trimethylsilyloxysilyl]oxysilane |
| SMILES | C[Si](C)(C)O[SiH](O[Si](C)(C)C)C(=Cc1ccccc1)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H52O5Si7/c1-30(2,3)24-29(25-31(4,5)6)23(21-22-19-17-16-18-20-22)35(26-32(7,8)9,27-33(10,11)12)28-34(13,14)15/h16-21,29H,1-15H3 |
| InChIKey | RZHLZTSKTQXHDU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.27 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|