C22H29F13O2Si3 — CID 173295393
trimethyl-[(3,3,4,4,5,5,6,6,7,7,10,10,10-tridecafluoro-1-phenyldec-1-en-2-yl)-trimethylsilyloxysilyl]oxysilane (PubChem CID 173295393) has the molecular formula C22H29F13O2Si3 and a molecular weight of 656.70 g/mol. Its IUPAC name is trimethyl-[(3,3,4,4,5,5,6,6,7,7,10,10,10-tridecafluoro-1-phenyldec-1-en-2-yl)-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[(3,3,4,4,5,5,6,6,7,7,10,10,10-tridecafluoro-1-phenyldec-1-en-2-yl)-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 173295393 |
| Molecular Formula | C22H29F13O2Si3 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | trimethyl-[(3,3,4,4,5,5,6,6,7,7,10,10,10-tridecafluoro-1-phenyldec-1-en-2-yl)-trimethylsilyloxysilyl]oxysilane |
| SMILES | C[Si](C)(C)O[SiH](O[Si](C)(C)C)C(=Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C22H29F13O2Si3/c1-39(2,3)36-38(37-40(4,5)6)16(14-15-10-8-7-9-11-15)19(28,29)21(32,33)22(34,35)20(30,31)17(23,24)12-13-18(25,26)27/h7-11,14,38H,12-13H2,1-6H3 |
| InChIKey | NBOKNBLSWGIWLN-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|