C25H18F26O2 — CID 15416142
(1S)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methoxy-1-phenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-ol (PubChem CID 15416142) has the molecular formula C25H18F26O2 and a molecular weight of 844.36 g/mol. Its IUPAC name is (1S)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methoxy-1-phenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-ol.
| Compound Name | (1S)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methoxy-1-phenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-ol |
|---|---|
| PubChem CID | 15416142 |
| Molecular Formula | C25H18F26O2 |
| Molecular Weight | 844.36 g/mol |
| Exact Mass | 844.09 |
| IUPAC Name | (1S)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methoxy-1-phenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-ol |
| SMILES | COC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H18F26O2/c1-53-13(12(52)11-5-3-2-4-6-11,7-9-14(26,27)16(30,31)18(34,35)20(38,39)22(42,43)24(46,47)48)8-10-15(28,29)17(32,33)19(36,37)21(40,41)23(44,45)25(49,50)51/h2-6,12,52H,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | VGFWLIAGBNKGDY-LBPRGKRZSA-N |
| XLogP | 11.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.36 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|