C33H23F39Sn — CID 11815207
2-phenylpropyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)stannane (PubChem CID 11815207) has the molecular formula C33H23F39Sn and a molecular weight of 1279.18 g/mol. Its IUPAC name is 2-phenylpropyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)stannane.
| Compound Name | 2-phenylpropyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)stannane |
|---|---|
| PubChem CID | 11815207 |
| Molecular Formula | C33H23F39Sn |
| Molecular Weight | 1279.18 g/mol |
| Exact Mass | 1280.02 |
| IUPAC Name | 2-phenylpropyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)stannane |
| SMILES | CC(C[Sn](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H11.3C8H4F13.Sn/c1-8(2)9-6-4-3-5-7-9;3*1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;/h3-8H,1H2,2H3;3*1-2H2; |
| InChIKey | SZFFMDJXZRJDKS-UHFFFAOYSA-N |
| XLogP | 17.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1279.18 |
| LogP ≤ 5 | 17.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|