C19H17F13O2 — CID 101159209
(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldecan-2-yl) 2-phenylacetate (PubChem CID 101159209) has the molecular formula C19H17F13O2 and a molecular weight of 524.32 g/mol. Its IUPAC name is (5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldecan-2-yl) 2-phenylacetate.
| Compound Name | (5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldecan-2-yl) 2-phenylacetate |
|---|---|
| PubChem CID | 101159209 |
| Molecular Formula | C19H17F13O2 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | (5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldecan-2-yl) 2-phenylacetate |
| SMILES | CC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H17F13O2/c1-13(2,34-12(33)10-11-6-4-3-5-7-11)8-9-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h3-7H,8-10H2,1-2H3 |
| InChIKey | WVYGETDDYBDGOO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|