C30H24F20N2O3 — CID 10930882
(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-[[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]carbamate (PubChem CID 10930882) has the molecular formula C30H24F20N2O3 and a molecular weight of 840.49 g/mol. Its IUPAC name is (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-[[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]carbamate.
| Compound Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-[[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 10930882 |
| Molecular Formula | C30H24F20N2O3 |
| Molecular Weight | 840.49 g/mol |
| Exact Mass | 840.15 |
| IUPAC Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-[[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)NCc1ccc(C(=O)NCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C30H24F20N2O3/c1-21(2,10-11-22(31,32)24(36,37)25(38,39)26(40,41)27(42,43)28(44,45)29(46,47)30(48,49)50)55-20(54)52-13-15-6-8-17(9-7-15)19(53)51-14-16-4-3-5-18(12-16)23(33,34)35/h3-9,12H,10-11,13-14H2,1-2H3,(H,51,53)(H,52,54) |
| InChIKey | RNRQXDSTNWOGGX-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.49 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|