C22H26F3NO — CID 69341997
N-[[4-(2-methylpentan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 69341997) has the molecular formula C22H26F3NO and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[[4-(2-methylpentan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[4-(2-methylpentan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 69341997 |
| Molecular Formula | C22H26F3NO |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-[[4-(2-methylpentan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCC(C)(C)c1ccc(CNC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H26F3NO/c1-4-12-21(2,3)18-10-8-16(9-11-18)15-26-20(27)14-17-6-5-7-19(13-17)22(23,24)25/h5-11,13H,4,12,14-15H2,1-3H3,(H,26,27) |
| InChIKey | TZJRQPJPYCFHLK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |